C32H57N3O3 — CID 4988342
2-(6-aminohexanoylamino)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-methylpentanamide (PubChem CID 4988342) has the molecular formula C32H57N3O3 and a molecular weight of 531.83 g/mol. Its IUPAC name is 2-(6-aminohexanoylamino)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-methylpentanamide.
| Compound Name | 2-(6-aminohexanoylamino)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 4988342 |
| Molecular Formula | C32H57N3O3 |
| Molecular Weight | 531.83 g/mol |
| Exact Mass | 531.44 |
| IUPAC Name | 2-(6-aminohexanoylamino)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-methylpentanamide |
| SMILES | CCC(C)C(NC(=O)CCCCCN)C(=O)NCCCCOc1ccc(C(C)(C)CC)cc1C(C)(C)CC |
| InChI | InChI=1S/C32H57N3O3/c1-9-24(4)29(35-28(36)17-13-12-14-20-33)30(37)34-21-15-16-22-38-27-19-18-25(31(5,6)10-2)23-26(27)32(7,8)11-3/h18-19,23-24,29H,9-17,20-22,33H2,1-8H3,(H,34,37)(H,35,36) |
| InChIKey | PKNRSAIKXJQGCL-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.83 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|