C20H22N2O4S — CID 55545581
3-benzoyl-N-[(2,5-dimethoxyphenyl)methyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 55545581) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is 3-benzoyl-N-[(2,5-dimethoxyphenyl)methyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-benzoyl-N-[(2,5-dimethoxyphenyl)methyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 55545581 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 3-benzoyl-N-[(2,5-dimethoxyphenyl)methyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | COc1ccc(OC)c(CNC(=O)C2CSCN2C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H22N2O4S/c1-25-16-8-9-18(26-2)15(10-16)11-21-19(23)17-12-27-13-22(17)20(24)14-6-4-3-5-7-14/h3-10,17H,11-13H2,1-2H3,(H,21,23) |
| InChIKey | NUEPOUUNRBFDSV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |