C15H21N3O2S — CID 120831309
3-benzoyl-N-[2-(methylamino)propyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 120831309) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 3-benzoyl-N-[2-(methylamino)propyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-benzoyl-N-[2-(methylamino)propyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 120831309 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 3-benzoyl-N-[2-(methylamino)propyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CNC(C)CNC(=O)C1CSCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H21N3O2S/c1-11(16-2)8-17-14(19)13-9-21-10-18(13)15(20)12-6-4-3-5-7-12/h3-7,11,13,16H,8-10H2,1-2H3,(H,17,19) |
| InChIKey | GOESFBVXQRICCC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |