C19H20N2O2S2 — CID 51331976
3-benzoyl-N-(2-phenylsulfanylethyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 51331976) has the molecular formula C19H20N2O2S2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 3-benzoyl-N-(2-phenylsulfanylethyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-benzoyl-N-(2-phenylsulfanylethyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 51331976 |
| Molecular Formula | C19H20N2O2S2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 3-benzoyl-N-(2-phenylsulfanylethyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(NCCSc1ccccc1)C1CSCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O2S2/c22-18(20-11-12-25-16-9-5-2-6-10-16)17-13-24-14-21(17)19(23)15-7-3-1-4-8-15/h1-10,17H,11-14H2,(H,20,22) |
| InChIKey | GLIZNOOFQKRNGX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|