C14H19NO5 — CID 71752843
(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 71752843) has the molecular formula C14H19NO5 and a molecular weight of 289.36 g/mol. Its IUPAC name is (2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 71752843 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | [2H]C1([2H])OC([2H])([2H])C([2H])([2H])N(C(=O)c2cc(OC)c(OC)c(OC)c2)C1([2H])[2H] |
| InChI | InChI=1S/C14H19NO5/c1-17-11-8-10(9-12(18-2)13(11)19-3)14(16)15-4-6-20-7-5-15/h8-9H,4-7H2,1-3H3/i4D2,5D2,6D2,7D2 |
| InChIKey | XWVOEFLBOSSYGM-DUSUNJSHSA-N |
| XLogP | 1.18 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |