C23H23N3O3 — CID 113028102
N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridinyl]-3,4-dimethoxybenzamide (PubChem CID 113028102) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridinyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridinyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 113028102 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridinyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(N3CCc4ccccc4C3)cn2)cc1OC |
| InChI | InChI=1S/C23H23N3O3/c1-28-20-9-7-17(13-21(20)29-2)23(27)25-22-10-8-19(14-24-22)26-12-11-16-5-3-4-6-18(16)15-26/h3-10,13-14H,11-12,15H2,1-2H3,(H,24,25,27) |
| InChIKey | JJLYQPLFSRIHLZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |