C22H27N5O2 — CID 109323353
N-(4-acetamidophenyl)-2-[2-(cyclohexen-1-yl)ethylamino]-6-methylpyrimidine-4-carboxamide (PubChem CID 109323353) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-[2-(cyclohexen-1-yl)ethylamino]-6-methylpyrimidine-4-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-2-[2-(cyclohexen-1-yl)ethylamino]-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109323353 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-(4-acetamidophenyl)-2-[2-(cyclohexen-1-yl)ethylamino]-6-methylpyrimidine-4-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2cc(C)nc(NCCC3=CCCCC3)n2)cc1 |
| InChI | InChI=1S/C22H27N5O2/c1-15-14-20(21(29)26-19-10-8-18(9-11-19)25-16(2)28)27-22(24-15)23-13-12-17-6-4-3-5-7-17/h6,8-11,14H,3-5,7,12-13H2,1-2H3,(H,25,28)(H,26,29)(H,23,24,27) |
| InChIKey | RNPPRIOCGRSRJW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|