C20H22F2N4O — CID 109323362
2-[2-(cyclohexen-1-yl)ethylamino]-N-(2,4-difluorophenyl)-6-methylpyrimidine-4-carboxamide (PubChem CID 109323362) has the molecular formula C20H22F2N4O and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethylamino]-N-(2,4-difluorophenyl)-6-methylpyrimidine-4-carboxamide.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethylamino]-N-(2,4-difluorophenyl)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109323362 |
| Molecular Formula | C20H22F2N4O |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethylamino]-N-(2,4-difluorophenyl)-6-methylpyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(F)cc2F)nc(NCCC2=CCCCC2)n1 |
| InChI | InChI=1S/C20H22F2N4O/c1-13-11-18(19(27)25-17-8-7-15(21)12-16(17)22)26-20(24-13)23-10-9-14-5-3-2-4-6-14/h5,7-8,11-12H,2-4,6,9-10H2,1H3,(H,25,27)(H,23,24,26) |
| InChIKey | GUVUSTKUJXVXMS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|