C17H26N4O2S — CID 111208688
1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine (PubChem CID 111208688) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111208688 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCCC1=CCCCC1)NCc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C17H26N4O2S/c1-19-17(20-11-10-14-6-3-2-4-7-14)21-13-15-8-5-9-16(12-15)24(18,22)23/h5-6,8-9,12H,2-4,7,10-11,13H2,1H3,(H2,18,22,23)(H2,19,20,21) |
| InChIKey | WHVGHGUQQSZAPE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|