C18H24IN5O4S — CID 111085284
2-benzyl-1,1-dimethyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide (PubChem CID 111085284) has the molecular formula C18H24IN5O4S and a molecular weight of 533.39 g/mol. Its IUPAC name is 2-benzyl-1,1-dimethyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide.
| Compound Name | 2-benzyl-1,1-dimethyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111085284 |
| Molecular Formula | C18H24IN5O4S |
| Molecular Weight | 533.39 g/mol |
| Exact Mass | 533.06 |
| IUPAC Name | 2-benzyl-1,1-dimethyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
| SMILES | CN(C)/C(=N\Cc1ccccc1)NCCNS(=O)(=O)c1cccc([N+](=O)[O-])c1.I |
| InChI | InChI=1S/C18H23N5O4S.HI/c1-22(2)18(20-14-15-7-4-3-5-8-15)19-11-12-21-28(26,27)17-10-6-9-16(13-17)23(24)25;/h3-10,13,21H,11-12,14H2,1-2H3,(H,19,20);1H |
| InChIKey | NSXUFUVYKQFGTI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|