C17H18N2O6S — CID 8879908
[(1S)-1-(3-nitrophenyl)ethyl] 3-(benzenesulfonamido)propanoate (PubChem CID 8879908) has the molecular formula C17H18N2O6S and a molecular weight of 378.41 g/mol. Its IUPAC name is [(1S)-1-(3-nitrophenyl)ethyl] 3-(benzenesulfonamido)propanoate.
| Compound Name | [(1S)-1-(3-nitrophenyl)ethyl] 3-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 8879908 |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | [(1S)-1-(3-nitrophenyl)ethyl] 3-(benzenesulfonamido)propanoate |
| SMILES | C[C@H](OC(=O)CCNS(=O)(=O)c1ccccc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H18N2O6S/c1-13(14-6-5-7-15(12-14)19(21)22)25-17(20)10-11-18-26(23,24)16-8-3-2-4-9-16/h2-9,12-13,18H,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | JRDBDTMHFCHVIB-ZDUSSCGKSA-N |
| XLogP | 2.57 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|