C13H16ClNO8S2 — CID 87675722
1-(3-nitrophenyl)ethyl 3-chloro-3,3-bis(methylsulfonyl)propanoate (PubChem CID 87675722) has the molecular formula C13H16ClNO8S2 and a molecular weight of 413.86 g/mol. Its IUPAC name is 1-(3-nitrophenyl)ethyl 3-chloro-3,3-bis(methylsulfonyl)propanoate.
| Compound Name | 1-(3-nitrophenyl)ethyl 3-chloro-3,3-bis(methylsulfonyl)propanoate |
|---|---|
| PubChem CID | 87675722 |
| Molecular Formula | C13H16ClNO8S2 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | 1-(3-nitrophenyl)ethyl 3-chloro-3,3-bis(methylsulfonyl)propanoate |
| SMILES | CC(OC(=O)CC(Cl)(S(C)(=O)=O)S(C)(=O)=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16ClNO8S2/c1-9(10-5-4-6-11(7-10)15(17)18)23-12(16)8-13(14,24(2,19)20)25(3,21)22/h4-7,9H,8H2,1-3H3 |
| InChIKey | VZKXINWZRJMCOJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 137.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|