C19H22N2O7S — CID 18273363
1-(3-nitrophenyl)ethyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate (PubChem CID 18273363) has the molecular formula C19H22N2O7S and a molecular weight of 422.46 g/mol. Its IUPAC name is 1-(3-nitrophenyl)ethyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate.
| Compound Name | 1-(3-nitrophenyl)ethyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 18273363 |
| Molecular Formula | C19H22N2O7S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 1-(3-nitrophenyl)ethyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
| SMILES | CCOc1ccc(S(=O)(=O)NCCC(=O)OC(C)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H22N2O7S/c1-3-27-17-7-9-18(10-8-17)29(25,26)20-12-11-19(22)28-14(2)15-5-4-6-16(13-15)21(23)24/h4-10,13-14,20H,3,11-12H2,1-2H3 |
| InChIKey | MKYUHCYZXMYXDR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|