C21H29N3O4S — CID 43001637
N-[2-(dimethylamino)-2-phenylethyl]-3-[(4-ethoxyphenyl)sulfonylamino]propanamide (PubChem CID 43001637) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-phenylethyl]-3-[(4-ethoxyphenyl)sulfonylamino]propanamide.
| Compound Name | N-[2-(dimethylamino)-2-phenylethyl]-3-[(4-ethoxyphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 43001637 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-[2-(dimethylamino)-2-phenylethyl]-3-[(4-ethoxyphenyl)sulfonylamino]propanamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCC(=O)NCC(c2ccccc2)N(C)C)cc1 |
| InChI | InChI=1S/C21H29N3O4S/c1-4-28-18-10-12-19(13-11-18)29(26,27)23-15-14-21(25)22-16-20(24(2)3)17-8-6-5-7-9-17/h5-13,20,23H,4,14-16H2,1-3H3,(H,22,25) |
| InChIKey | CTNSPFJIRWDJSZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |