C24H29N3O3S — CID 41203632
N-[(2R)-2-(dimethylamino)-2-phenylethyl]-4-(naphthalen-2-ylsulfonylamino)butanamide (PubChem CID 41203632) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-[(2R)-2-(dimethylamino)-2-phenylethyl]-4-(naphthalen-2-ylsulfonylamino)butanamide.
| Compound Name | N-[(2R)-2-(dimethylamino)-2-phenylethyl]-4-(naphthalen-2-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 41203632 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[(2R)-2-(dimethylamino)-2-phenylethyl]-4-(naphthalen-2-ylsulfonylamino)butanamide |
| SMILES | CN(C)[C@@H](CNC(=O)CCCNS(=O)(=O)c1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C24H29N3O3S/c1-27(2)23(20-10-4-3-5-11-20)18-25-24(28)13-8-16-26-31(29,30)22-15-14-19-9-6-7-12-21(19)17-22/h3-7,9-12,14-15,17,23,26H,8,13,16,18H2,1-2H3,(H,25,28)/t23-/m0/s1 |
| InChIKey | LSBMNVWFVATQSO-QHCPKHFHSA-N |
| XLogP | 3.32 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|