C16H27N3O4S — CID 120653177
3-[(4-ethoxyphenyl)sulfonylamino]-N-[(2R)-2-(ethylamino)propyl]propanamide (PubChem CID 120653177) has the molecular formula C16H27N3O4S and a molecular weight of 357.48 g/mol. Its IUPAC name is 3-[(4-ethoxyphenyl)sulfonylamino]-N-[(2R)-2-(ethylamino)propyl]propanamide.
| Compound Name | 3-[(4-ethoxyphenyl)sulfonylamino]-N-[(2R)-2-(ethylamino)propyl]propanamide |
|---|---|
| PubChem CID | 120653177 |
| Molecular Formula | C16H27N3O4S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 3-[(4-ethoxyphenyl)sulfonylamino]-N-[(2R)-2-(ethylamino)propyl]propanamide |
| SMILES | CCN[C@H](C)CNC(=O)CCNS(=O)(=O)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C16H27N3O4S/c1-4-17-13(3)12-18-16(20)10-11-19-24(21,22)15-8-6-14(7-9-15)23-5-2/h6-9,13,17,19H,4-5,10-12H2,1-3H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | YXLWFRHANTTZCZ-CYBMUJFWSA-N |
| XLogP | 0.87 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |