C17H26N2O6S — CID 119188454
2-[3-[(4-ethoxyphenyl)sulfonylamino]propanoylamino]-4-methylpentanoic acid (PubChem CID 119188454) has the molecular formula C17H26N2O6S and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-[3-[(4-ethoxyphenyl)sulfonylamino]propanoylamino]-4-methylpentanoic acid.
| Compound Name | 2-[3-[(4-ethoxyphenyl)sulfonylamino]propanoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119188454 |
| Molecular Formula | C17H26N2O6S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-[3-[(4-ethoxyphenyl)sulfonylamino]propanoylamino]-4-methylpentanoic acid |
| SMILES | CCOc1ccc(S(=O)(=O)NCCC(=O)NC(CC(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C17H26N2O6S/c1-4-25-13-5-7-14(8-6-13)26(23,24)18-10-9-16(20)19-15(17(21)22)11-12(2)3/h5-8,12,15,18H,4,9-11H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | VIDCYMWPHABAHA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |