About 1-(3-nitrophenyl)ethyl 4-methylsulfanylbenzoate
1-(3-nitrophenyl)ethyl 4-methylsulfanylbenzoate (PubChem CID 18092152) has the molecular formula C16H15NO4S
and a molecular weight of 317.37 g/mol. Its IUPAC name is 1-(3-nitrophenyl)ethyl 4-methylsulfanylbenzoate.
Molecular Properties
| Compound Name | 1-(3-nitrophenyl)ethyl 4-methylsulfanylbenzoate |
| PubChem CID | 18092152 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 1-(3-nitrophenyl)ethyl 4-methylsulfanylbenzoate |
| SMILES | CSc1ccc(C(=O)OC(C)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C16H15NO4S/c1-11(13-4-3-5-14(10-13)17(19)20)21-16(18)12-6-8-15(22-2)9-7-12/h3-11H,1-2H3 |
| InChIKey | MVBMOUQRLUPJGW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-nitrophenyl)ethyl 4-methylsulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-nitrophenyl)ethyl 4-methylsulfanylbenzoate?
The IUPAC name of 1-(3-nitrophenyl)ethyl 4-methylsulfanylbenzoate (CID 18092152) is 1-(3-nitrophenyl)ethyl 4-methylsulfanylbenzoate.
What is the SMILES notation for 1-(3-nitrophenyl)ethyl 4-methylsulfanylbenzoate?
The canonical SMILES for 1-(3-nitrophenyl)ethyl 4-methylsulfanylbenzoate is CSc1ccc(C(=O)OC(C)c2cccc([N+](=O)[O-])c2)cc1.
What is the InChIKey of 1-(3-nitrophenyl)ethyl 4-methylsulfanylbenzoate?
The InChIKey is MVBMOUQRLUPJGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO4S/c1-11(13-4-3-5-14(10-13)17(19)20)21-16(18)12-6-8-15(22-2)9-7-12/h3-11H,1-2H3.
What are the key properties of 1-(3-nitrophenyl)ethyl 4-methylsulfanylbenzoate?
1-(3-nitrophenyl)ethyl 4-methylsulfanylbenzoate has a molecular weight of 317.37 g/mol, XLogP of 4.23, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-nitrophenyl)ethyl 4-methylsulfanylbenzoate is sourced from PubChem (CID 18092152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).