C14H21ClN4O4 — CID 120919758
(2R,3S)-2-methyl-N-[2-(2-nitroanilino)ethyl]morpholine-3-carboxamide;hydrochloride (PubChem CID 120919758) has the molecular formula C14H21ClN4O4 and a molecular weight of 344.80 g/mol. Its IUPAC name is (2R,3S)-2-methyl-N-[2-(2-nitroanilino)ethyl]morpholine-3-carboxamide;hydrochloride.
| Compound Name | (2R,3S)-2-methyl-N-[2-(2-nitroanilino)ethyl]morpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120919758 |
| Molecular Formula | C14H21ClN4O4 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2R,3S)-2-methyl-N-[2-(2-nitroanilino)ethyl]morpholine-3-carboxamide;hydrochloride |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)NCCNc1ccccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C14H20N4O4.ClH/c1-10-13(16-8-9-22-10)14(19)17-7-6-15-11-4-2-3-5-12(11)18(20)21;/h2-5,10,13,15-16H,6-9H2,1H3,(H,17,19);1H/t10-,13+;/m1./s1 |
| InChIKey | HNMGRBRKPCQQGJ-HTKOBJQYSA-N |
| XLogP | 0.92 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|