C19H28N4O5 — CID 97247486
tert-butyl (3R,4S)-3-methyl-4-[2-(2-nitroanilino)ethylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 97247486) has the molecular formula C19H28N4O5 and a molecular weight of 392.46 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-methyl-4-[2-(2-nitroanilino)ethylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3-methyl-4-[2-(2-nitroanilino)ethylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 97247486 |
| Molecular Formula | C19H28N4O5 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | tert-butyl (3R,4S)-3-methyl-4-[2-(2-nitroanilino)ethylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)C[C@H]1C(=O)NCCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H28N4O5/c1-13-11-22(18(25)28-19(2,3)4)12-14(13)17(24)21-10-9-20-15-7-5-6-8-16(15)23(26)27/h5-8,13-14,20H,9-12H2,1-4H3,(H,21,24)/t13-,14+/m0/s1 |
| InChIKey | GOBQTERLIORSNT-UONOGXRCSA-N |
| XLogP | 2.63 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|