C27H35N3O6 — CID 154961403
tert-butyl (3R,4R)-3,4-bis[2-(4-hydroxyphenyl)ethylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 154961403) has the molecular formula C27H35N3O6 and a molecular weight of 497.59 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3,4-bis[2-(4-hydroxyphenyl)ethylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3,4-bis[2-(4-hydroxyphenyl)ethylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 154961403 |
| Molecular Formula | C27H35N3O6 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | tert-butyl (3R,4R)-3,4-bis[2-(4-hydroxyphenyl)ethylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C(=O)NCCc2ccc(O)cc2)[C@@H](C(=O)NCCc2ccc(O)cc2)C1 |
| InChI | InChI=1S/C27H35N3O6/c1-27(2,3)36-26(35)30-16-22(24(33)28-14-12-18-4-8-20(31)9-5-18)23(17-30)25(34)29-15-13-19-6-10-21(32)11-7-19/h4-11,22-23,31-32H,12-17H2,1-3H3,(H,28,33)(H,29,34)/t22-,23-/m0/s1 |
| InChIKey | APPJVIUKCJRLMV-GOTSBHOMSA-N |
| XLogP | 2.60 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |