C15H20N2O5 — CID 120925919
(2R,3S)-N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-methylmorpholine-3-carboxamide (PubChem CID 120925919) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is (2R,3S)-N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-methylmorpholine-3-carboxamide.
| Compound Name | (2R,3S)-N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 120925919 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (2R,3S)-N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-methylmorpholine-3-carboxamide |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)NCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H20N2O5/c1-10-14(16-4-6-19-10)15(18)17-5-7-20-11-2-3-12-13(8-11)22-9-21-12/h2-3,8,10,14,16H,4-7,9H2,1H3,(H,17,18)/t10-,14+/m1/s1 |
| InChIKey | PKAGWHWNYXCGLN-YGRLFVJLSA-N |
| XLogP | 0.29 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|