C14H15NO6 — CID 125119800
trans-(1R,2R)-2-[2-(1,3-benzodioxol-5-yloxy)ethylcarbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 125119800) has the molecular formula C14H15NO6 and a molecular weight of 293.27 g/mol. Its IUPAC name is trans-(1R,2R)-2-[2-(1,3-benzodioxol-5-yloxy)ethylcarbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | trans-(1R,2R)-2-[2-(1,3-benzodioxol-5-yloxy)ethylcarbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 125119800 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | trans-(1R,2R)-2-[2-(1,3-benzodioxol-5-yloxy)ethylcarbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H]1C(=O)NCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H15NO6/c16-13(9-6-10(9)14(17)18)15-3-4-19-8-1-2-11-12(5-8)21-7-20-11/h1-2,5,9-10H,3-4,6-7H2,(H,15,16)(H,17,18)/t9-,10-/m1/s1 |
| InChIKey | OYPZYAZGODRKLI-NXEZZACHSA-N |
| XLogP | 0.63 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|