C16H20N2O5 — CID 109132923
1-N-(1,3-benzodioxol-5-ylmethyl)-2-N-(2-methoxyethyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109132923) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-N-(1,3-benzodioxol-5-ylmethyl)-2-N-(2-methoxyethyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(1,3-benzodioxol-5-ylmethyl)-2-N-(2-methoxyethyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109132923 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-N-(1,3-benzodioxol-5-ylmethyl)-2-N-(2-methoxyethyl)cyclopropane-1,2-dicarboxamide |
| SMILES | COCCNC(=O)C1CC1C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H20N2O5/c1-21-5-4-17-15(19)11-7-12(11)16(20)18-8-10-2-3-13-14(6-10)23-9-22-13/h2-3,6,11-12H,4-5,7-9H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | GDWMPDMTZHDFIH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|