C18H24N2O5 — CID 124797819
(3S,3aR,6aR)-5-(1,3-benzodioxol-5-ylmethyl)-N-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide (PubChem CID 124797819) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is (3S,3aR,6aR)-5-(1,3-benzodioxol-5-ylmethyl)-N-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide.
| Compound Name | (3S,3aR,6aR)-5-(1,3-benzodioxol-5-ylmethyl)-N-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 124797819 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (3S,3aR,6aR)-5-(1,3-benzodioxol-5-ylmethyl)-N-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1CO[C@H]2CN(Cc3ccc4c(c3)OCO4)C[C@H]21 |
| InChI | InChI=1S/C18H24N2O5/c1-22-5-4-19-18(21)14-10-23-17-9-20(8-13(14)17)7-12-2-3-15-16(6-12)25-11-24-15/h2-3,6,13-14,17H,4-5,7-11H2,1H3,(H,19,21)/t13-,14+,17-/m0/s1 |
| InChIKey | WOBQSYVTUMGPLW-VBQJREDUSA-N |
| XLogP | 0.62 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|