C19H18N2O5 — CID 55747326
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide (PubChem CID 55747326) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 55747326 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide |
| SMILES | O=C1CC(C(=O)NCCOc2ccc3c(c2)OCO3)c2ccccc2N1 |
| InChI | InChI=1S/C19H18N2O5/c22-18-10-14(13-3-1-2-4-15(13)21-18)19(23)20-7-8-24-12-5-6-16-17(9-12)26-11-25-16/h1-6,9,14H,7-8,10-11H2,(H,20,23)(H,21,22) |
| InChIKey | SKKANIAMJBUTOZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|