C11H11F2IN2O2 — CID 119764590
N-(3,5-difluoro-4-iodophenyl)morpholine-3-carboxamide (PubChem CID 119764590) has the molecular formula C11H11F2IN2O2 and a molecular weight of 368.12 g/mol. Its IUPAC name is N-(3,5-difluoro-4-iodophenyl)morpholine-3-carboxamide.
| Compound Name | N-(3,5-difluoro-4-iodophenyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 119764590 |
| Molecular Formula | C11H11F2IN2O2 |
| Molecular Weight | 368.12 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | N-(3,5-difluoro-4-iodophenyl)morpholine-3-carboxamide |
| SMILES | O=C(Nc1cc(F)c(I)c(F)c1)C1COCCN1 |
| InChI | InChI=1S/C11H11F2IN2O2/c12-7-3-6(4-8(13)10(7)14)16-11(17)9-5-18-2-1-15-9/h3-4,9,15H,1-2,5H2,(H,16,17) |
| InChIKey | MDYZOKOKNWIHQP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.12 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|