C13H22N2OS — CID 115090336
1-[2-(1-propan-2-ylpiperidin-3-yl)-1,3-thiazol-5-yl]ethanol (PubChem CID 115090336) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is 1-[2-(1-propan-2-ylpiperidin-3-yl)-1,3-thiazol-5-yl]ethanol.
| Compound Name | 1-[2-(1-propan-2-ylpiperidin-3-yl)-1,3-thiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 115090336 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-[2-(1-propan-2-ylpiperidin-3-yl)-1,3-thiazol-5-yl]ethanol |
| SMILES | CC(O)c1cnc(C2CCCN(C(C)C)C2)s1 |
| InChI | InChI=1S/C13H22N2OS/c1-9(2)15-6-4-5-11(8-15)13-14-7-12(17-13)10(3)16/h7,9-11,16H,4-6,8H2,1-3H3 |
| InChIKey | WXJLICXYJCZMMW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |