C10H16N2S2 — CID 115089939
1-[2-(thian-4-yl)-1,3-thiazol-5-yl]ethanamine (PubChem CID 115089939) has the molecular formula C10H16N2S2 and a molecular weight of 228.39 g/mol. Its IUPAC name is 1-[2-(thian-4-yl)-1,3-thiazol-5-yl]ethanamine.
| Compound Name | 1-[2-(thian-4-yl)-1,3-thiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 115089939 |
| Molecular Formula | C10H16N2S2 |
| Molecular Weight | 228.39 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 1-[2-(thian-4-yl)-1,3-thiazol-5-yl]ethanamine |
| SMILES | CC(N)c1cnc(C2CCSCC2)s1 |
| InChI | InChI=1S/C10H16N2S2/c1-7(11)9-6-12-10(14-9)8-2-4-13-5-3-8/h6-8H,2-5,11H2,1H3 |
| InChIKey | YIYNEFHQVAMKCD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |