C10H17N3S — CID 115090671
1-(2-piperidin-2-yl-1,3-thiazol-5-yl)ethanamine (PubChem CID 115090671) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 1-(2-piperidin-2-yl-1,3-thiazol-5-yl)ethanamine.
| Compound Name | 1-(2-piperidin-2-yl-1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 115090671 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1-(2-piperidin-2-yl-1,3-thiazol-5-yl)ethanamine |
| SMILES | CC(N)c1cnc(C2CCCCN2)s1 |
| InChI | InChI=1S/C10H17N3S/c1-7(11)9-6-13-10(14-9)8-4-2-3-5-12-8/h6-8,12H,2-5,11H2,1H3 |
| InChIKey | LJFGOZSSBHZPHY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |