C10H15N3OS — CID 124955227
N-methyl-2-[(2S)-piperidin-2-yl]-1,3-thiazole-5-carboxamide (PubChem CID 124955227) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is N-methyl-2-[(2S)-piperidin-2-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-methyl-2-[(2S)-piperidin-2-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 124955227 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | N-methyl-2-[(2S)-piperidin-2-yl]-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)c1cnc([C@@H]2CCCCN2)s1 |
| InChI | InChI=1S/C10H15N3OS/c1-11-9(14)8-6-13-10(15-8)7-4-2-3-5-12-7/h6-7,12H,2-5H2,1H3,(H,11,14)/t7-/m0/s1 |
| InChIKey | FIGIERWJNSQQRN-ZETCQYMHSA-N |
| XLogP | 1.32 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |