C10H15NS — CID 126992198
4-cyclobutyl-2-propan-2-yl-1,3-thiazole (PubChem CID 126992198) has the molecular formula C10H15NS and a molecular weight of 181.30 g/mol. Its IUPAC name is 4-cyclobutyl-2-propan-2-yl-1,3-thiazole.
| Compound Name | 4-cyclobutyl-2-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 126992198 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 4-cyclobutyl-2-propan-2-yl-1,3-thiazole |
| SMILES | CC(C)c1nc(C2CCC2)cs1 |
| InChI | InChI=1S/C10H15NS/c1-7(2)10-11-9(6-12-10)8-4-3-5-8/h6-8H,3-5H2,1-2H3 |
| InChIKey | NBJMZSYIBLEHHY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |