C16H19NOS — CID 63346475
(4-cyclohexyl-1,3-thiazol-2-yl)-phenylmethanol (PubChem CID 63346475) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is (4-cyclohexyl-1,3-thiazol-2-yl)-phenylmethanol.
| Compound Name | (4-cyclohexyl-1,3-thiazol-2-yl)-phenylmethanol |
|---|---|
| PubChem CID | 63346475 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (4-cyclohexyl-1,3-thiazol-2-yl)-phenylmethanol |
| SMILES | OC(c1ccccc1)c1nc(C2CCCCC2)cs1 |
| InChI | InChI=1S/C16H19NOS/c18-15(13-9-5-2-6-10-13)16-17-14(11-19-16)12-7-3-1-4-8-12/h2,5-6,9-12,15,18H,1,3-4,7-8H2 |
| InChIKey | HZHZUNPFIKUAEN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |