C13H21NOS — CID 116967273
2-(4-cyclohexyl-1,3-thiazol-2-yl)butan-1-ol (PubChem CID 116967273) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is 2-(4-cyclohexyl-1,3-thiazol-2-yl)butan-1-ol.
| Compound Name | 2-(4-cyclohexyl-1,3-thiazol-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 116967273 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-(4-cyclohexyl-1,3-thiazol-2-yl)butan-1-ol |
| SMILES | CCC(CO)c1nc(C2CCCCC2)cs1 |
| InChI | InChI=1S/C13H21NOS/c1-2-10(8-15)13-14-12(9-16-13)11-6-4-3-5-7-11/h9-11,15H,2-8H2,1H3 |
| InChIKey | NJPDRQVJDDYEJN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |