C12H19NS — CID 130157916
4-cyclohexyl-2-propyl-1,3-thiazole (PubChem CID 130157916) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is 4-cyclohexyl-2-propyl-1,3-thiazole.
| Compound Name | 4-cyclohexyl-2-propyl-1,3-thiazole |
|---|---|
| PubChem CID | 130157916 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 4-cyclohexyl-2-propyl-1,3-thiazole |
| SMILES | CCCc1nc(C2CCCCC2)cs1 |
| InChI | InChI=1S/C12H19NS/c1-2-6-12-13-11(9-14-12)10-7-4-3-5-8-10/h9-10H,2-8H2,1H3 |
| InChIKey | DUAFZBODDMHTJV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |