C9H12BrNS — CID 116970375
2-(bromomethyl)-4-cyclopentyl-1,3-thiazole (PubChem CID 116970375) has the molecular formula C9H12BrNS and a molecular weight of 246.17 g/mol. Its IUPAC name is 2-(bromomethyl)-4-cyclopentyl-1,3-thiazole.
| Compound Name | 2-(bromomethyl)-4-cyclopentyl-1,3-thiazole |
|---|---|
| PubChem CID | 116970375 |
| Molecular Formula | C9H12BrNS |
| Molecular Weight | 246.17 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 2-(bromomethyl)-4-cyclopentyl-1,3-thiazole |
| SMILES | BrCc1nc(C2CCCC2)cs1 |
| InChI | InChI=1S/C9H12BrNS/c10-5-9-11-8(6-12-9)7-3-1-2-4-7/h6-7H,1-5H2 |
| InChIKey | PLECECMSIFOAQK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.17 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|