C13H19N3S — CID 116968995
4-[4-(1-methylpiperidin-4-yl)-1,3-thiazol-2-yl]butanenitrile (PubChem CID 116968995) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 4-[4-(1-methylpiperidin-4-yl)-1,3-thiazol-2-yl]butanenitrile.
| Compound Name | 4-[4-(1-methylpiperidin-4-yl)-1,3-thiazol-2-yl]butanenitrile |
|---|---|
| PubChem CID | 116968995 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 4-[4-(1-methylpiperidin-4-yl)-1,3-thiazol-2-yl]butanenitrile |
| SMILES | CN1CCC(c2csc(CCCC#N)n2)CC1 |
| InChI | InChI=1S/C13H19N3S/c1-16-8-5-11(6-9-16)12-10-17-13(15-12)4-2-3-7-14/h10-11H,2-6,8-9H2,1H3 |
| InChIKey | KKAYJDROUKRZMF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|