C8H10N2OS — CID 116967982
4-cyclobutyl-1,3-thiazole-2-carboxamide (PubChem CID 116967982) has the molecular formula C8H10N2OS and a molecular weight of 182.25 g/mol. Its IUPAC name is 4-cyclobutyl-1,3-thiazole-2-carboxamide.
| Compound Name | 4-cyclobutyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 116967982 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 4-cyclobutyl-1,3-thiazole-2-carboxamide |
| SMILES | NC(=O)c1nc(C2CCC2)cs1 |
| InChI | InChI=1S/C8H10N2OS/c9-7(11)8-10-6(4-12-8)5-2-1-3-5/h4-5H,1-3H2,(H2,9,11) |
| InChIKey | ZRUZMQNHUXVEJA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |