C11H13NO2S — CID 116868057
(E)-3-(4-cyclopentyl-1,3-thiazol-2-yl)prop-2-enoic acid (PubChem CID 116868057) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is (E)-3-(4-cyclopentyl-1,3-thiazol-2-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(4-cyclopentyl-1,3-thiazol-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 116868057 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | (E)-3-(4-cyclopentyl-1,3-thiazol-2-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1nc(C2CCCC2)cs1 |
| InChI | InChI=1S/C11H13NO2S/c13-11(14)6-5-10-12-9(7-15-10)8-3-1-2-4-8/h5-8H,1-4H2,(H,13,14)/b6-5+ |
| InChIKey | HLOBYFTZVYVNEH-AATRIKPKSA-N |
| XLogP | 2.90 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|