C10H13NO2S — CID 116868026
(E)-3-[4-(2-methylpropyl)-1,3-thiazol-2-yl]prop-2-enoic acid (PubChem CID 116868026) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is (E)-3-[4-(2-methylpropyl)-1,3-thiazol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(2-methylpropyl)-1,3-thiazol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 116868026 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | (E)-3-[4-(2-methylpropyl)-1,3-thiazol-2-yl]prop-2-enoic acid |
| SMILES | CC(C)Cc1csc(/C=C/C(=O)O)n1 |
| InChI | InChI=1S/C10H13NO2S/c1-7(2)5-8-6-14-9(11-8)3-4-10(12)13/h3-4,6-7H,5H2,1-2H3,(H,12,13)/b4-3+ |
| InChIKey | XRXHHAPBLHPLCQ-ONEGZZNKSA-N |
| XLogP | 2.44 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|