C21H12F3N3OS — CID 108748572
2,3,4-trifluoro-N-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]benzamide (PubChem CID 108748572) has the molecular formula C21H12F3N3OS and a molecular weight of 411.41 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 108748572 |
| Molecular Formula | C21H12F3N3OS |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 2,3,4-trifluoro-N-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2csc(-c3cccnc3)n2)c1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H12F3N3OS/c22-16-7-6-15(18(23)19(16)24)20(28)26-14-5-1-3-12(9-14)17-11-29-21(27-17)13-4-2-8-25-10-13/h1-11H,(H,26,28) |
| InChIKey | CIUOVXUVCPZSME-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|