C16H14N2OS — CID 885223
4-(4-methoxy-3-methylphenyl)-2-pyridin-3-yl-1,3-thiazole (PubChem CID 885223) has the molecular formula C16H14N2OS and a molecular weight of 282.37 g/mol. Its IUPAC name is 4-(4-methoxy-3-methylphenyl)-2-pyridin-3-yl-1,3-thiazole.
| Compound Name | 4-(4-methoxy-3-methylphenyl)-2-pyridin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 885223 |
| Molecular Formula | C16H14N2OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 4-(4-methoxy-3-methylphenyl)-2-pyridin-3-yl-1,3-thiazole |
| SMILES | COc1ccc(-c2csc(-c3cccnc3)n2)cc1C |
| InChI | InChI=1S/C16H14N2OS/c1-11-8-12(5-6-15(11)19-2)14-10-20-16(18-14)13-4-3-7-17-9-13/h3-10H,1-2H3 |
| InChIKey | QFDGBXGUGNJDPI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |