C14H9N3O2S — CID 104826784
2-(4-pyridin-3-yl-1,3-thiazol-2-yl)pyridine-4-carboxylic acid (PubChem CID 104826784) has the molecular formula C14H9N3O2S and a molecular weight of 283.31 g/mol. Its IUPAC name is 2-(4-pyridin-3-yl-1,3-thiazol-2-yl)pyridine-4-carboxylic acid.
| Compound Name | 2-(4-pyridin-3-yl-1,3-thiazol-2-yl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 104826784 |
| Molecular Formula | C14H9N3O2S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2-(4-pyridin-3-yl-1,3-thiazol-2-yl)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(-c2nc(-c3cccnc3)cs2)c1 |
| InChI | InChI=1S/C14H9N3O2S/c18-14(19)9-3-5-16-11(6-9)13-17-12(8-20-13)10-2-1-4-15-7-10/h1-8H,(H,18,19) |
| InChIKey | HRXYMDFMAIFFTG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |