C19H10N2O7 — CID 3970066
[2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] furan-2-carboxylate (PubChem CID 3970066) has the molecular formula C19H10N2O7 and a molecular weight of 378.30 g/mol. Its IUPAC name is [2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] furan-2-carboxylate.
| Compound Name | [2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 3970066 |
| Molecular Formula | C19H10N2O7 |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | [2-(4-nitro-1,3-dioxoisoindol-2-yl)phenyl] furan-2-carboxylate |
| SMILES | O=C(Oc1ccccc1N1C(=O)c2cccc([N+](=O)[O-])c2C1=O)c1ccco1 |
| InChI | InChI=1S/C19H10N2O7/c22-17-11-5-3-7-13(21(25)26)16(11)18(23)20(17)12-6-1-2-8-14(12)28-19(24)15-9-4-10-27-15/h1-10H |
| InChIKey | XPNHPMPNTQBMIV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 119.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|