C29H18N2O7 — CID 126189268
[(1S)-2-oxo-1,2-diphenylethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 126189268) has the molecular formula C29H18N2O7 and a molecular weight of 506.47 g/mol. Its IUPAC name is [(1S)-2-oxo-1,2-diphenylethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [(1S)-2-oxo-1,2-diphenylethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 126189268 |
| Molecular Formula | C29H18N2O7 |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | [(1S)-2-oxo-1,2-diphenylethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | O=C(O[C@H](C(=O)c1ccccc1)c1ccccc1)c1ccccc1N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C29H18N2O7/c32-25(18-10-3-1-4-11-18)26(19-12-5-2-6-13-19)38-29(35)20-14-7-8-16-22(20)30-27(33)21-15-9-17-23(31(36)37)24(21)28(30)34/h1-17,26H/t26-/m0/s1 |
| InChIKey | QYRFOJDCMJKJRJ-SANMLTNESA-N |
| XLogP | 5.18 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|