C30H17N3O11 — CID 19646149
[2-[4-(4-nitrobenzoyl)oxyphenyl]-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 19646149) has the molecular formula C30H17N3O11 and a molecular weight of 595.48 g/mol. Its IUPAC name is [2-[4-(4-nitrobenzoyl)oxyphenyl]-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-[4-(4-nitrobenzoyl)oxyphenyl]-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 19646149 |
| Molecular Formula | C30H17N3O11 |
| Molecular Weight | 595.48 g/mol |
| Exact Mass | 595.09 |
| IUPAC Name | [2-[4-(4-nitrobenzoyl)oxyphenyl]-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1N1C(=O)c2cccc([N+](=O)[O-])c2C1=O)c1ccc(OC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C30H17N3O11/c34-25(17-10-14-20(15-11-17)44-29(37)18-8-12-19(13-9-18)32(39)40)16-43-30(38)21-4-1-2-6-23(21)31-27(35)22-5-3-7-24(33(41)42)26(22)28(31)36/h1-15H,16H2 |
| InChIKey | DGUVMTQTZNLORK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 193.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|