C31H20N2O10 — CID 19646151
[2-[4-(3-methoxybenzoyl)oxyphenyl]-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 19646151) has the molecular formula C31H20N2O10 and a molecular weight of 580.51 g/mol. Its IUPAC name is [2-[4-(3-methoxybenzoyl)oxyphenyl]-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-[4-(3-methoxybenzoyl)oxyphenyl]-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 19646151 |
| Molecular Formula | C31H20N2O10 |
| Molecular Weight | 580.51 g/mol |
| Exact Mass | 580.11 |
| IUPAC Name | [2-[4-(3-methoxybenzoyl)oxyphenyl]-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(C(=O)COC(=O)c3ccccc3N3C(=O)c4cccc([N+](=O)[O-])c4C3=O)cc2)c1 |
| InChI | InChI=1S/C31H20N2O10/c1-41-21-7-4-6-19(16-21)30(37)43-20-14-12-18(13-15-20)26(34)17-42-31(38)22-8-2-3-10-24(22)32-28(35)23-9-5-11-25(33(39)40)27(23)29(32)36/h2-16H,17H2,1H3 |
| InChIKey | JHSSLJPUISAYNZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 159.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|