C26H19ClN2O8 — CID 126187889
[2-(3,4-dimethylphenyl)-2-oxoethyl] 5-chloro-2-methoxy-4-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 126187889) has the molecular formula C26H19ClN2O8 and a molecular weight of 522.90 g/mol. Its IUPAC name is [2-(3,4-dimethylphenyl)-2-oxoethyl] 5-chloro-2-methoxy-4-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] 5-chloro-2-methoxy-4-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 126187889 |
| Molecular Formula | C26H19ClN2O8 |
| Molecular Weight | 522.90 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] 5-chloro-2-methoxy-4-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | COc1cc(N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c(Cl)cc1C(=O)OCC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C26H19ClN2O8/c1-13-7-8-15(9-14(13)2)21(30)12-37-26(33)17-10-18(27)20(11-22(17)36-3)28-24(31)16-5-4-6-19(29(34)35)23(16)25(28)32/h4-11H,12H2,1-3H3 |
| InChIKey | DHSVVPXCIDWGOU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.90 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|