C24H15Cl2NO5 — CID 1213989
[2-(3,4-dichlorophenyl)-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)-4-methylbenzoate (PubChem CID 1213989) has the molecular formula C24H15Cl2NO5 and a molecular weight of 468.29 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)-4-methylbenzoate.
| Compound Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)-4-methylbenzoate |
|---|---|
| PubChem CID | 1213989 |
| Molecular Formula | C24H15Cl2NO5 |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)c2ccc(Cl)c(Cl)c2)cc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H15Cl2NO5/c1-13-6-7-15(24(31)32-12-21(28)14-8-9-18(25)19(26)10-14)11-20(13)27-22(29)16-4-2-3-5-17(16)23(27)30/h2-11H,12H2,1H3 |
| InChIKey | MLMPLOMEVILPCV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|