C34H23N3O12 — CID 126185444
[2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-[2-[2-(4-methyl-3-nitrophenyl)-2-oxoethoxy]carbonylphenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 126185444) has the molecular formula C34H23N3O12 and a molecular weight of 665.57 g/mol. Its IUPAC name is [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-[2-[2-(4-methyl-3-nitrophenyl)-2-oxoethoxy]carbonylphenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-[2-[2-(4-methyl-3-nitrophenyl)-2-oxoethoxy]carbonylphenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 126185444 |
| Molecular Formula | C34H23N3O12 |
| Molecular Weight | 665.57 g/mol |
| Exact Mass | 665.13 |
| IUPAC Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-[2-[2-(4-methyl-3-nitrophenyl)-2-oxoethoxy]carbonylphenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccc3c(c2)C(=O)N(c2ccccc2C(=O)OCC(=O)c2ccc(C)c([N+](=O)[O-])c2)C3=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C34H23N3O12/c1-18-7-9-20(14-27(18)36(44)45)29(38)16-48-33(42)22-11-12-23-25(13-22)32(41)35(31(23)40)26-6-4-3-5-24(26)34(43)49-17-30(39)21-10-8-19(2)28(15-21)37(46)47/h3-15H,16-17H2,1-2H3 |
| InChIKey | KORLMIIDYQRMEY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 210.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|